C12H11FIN3O2S — CID 79769202
3-amino-5-(4-fluoro-2-iodoanilino)benzenesulfonamide (PubChem CID 79769202) has the molecular formula C12H11FIN3O2S and a molecular weight of 407.21 g/mol. Its IUPAC name is 3-amino-5-(4-fluoro-2-iodoanilino)benzenesulfonamide.
| Compound Name | 3-amino-5-(4-fluoro-2-iodoanilino)benzenesulfonamide |
|---|---|
| PubChem CID | 79769202 |
| Molecular Formula | C12H11FIN3O2S |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | 3-amino-5-(4-fluoro-2-iodoanilino)benzenesulfonamide |
| SMILES | Nc1cc(Nc2ccc(F)cc2I)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H11FIN3O2S/c13-7-1-2-12(11(14)3-7)17-9-4-8(15)5-10(6-9)20(16,18)19/h1-6,17H,15H2,(H2,16,18,19) |
| InChIKey | ATAVWLTXOWRCEL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|