C9H7Cl2FIN — CID 79769670
N-(2,3-dichloroprop-2-enyl)-4-fluoro-2-iodoaniline (PubChem CID 79769670) has the molecular formula C9H7Cl2FIN and a molecular weight of 345.97 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)-4-fluoro-2-iodoaniline.
| Compound Name | N-(2,3-dichloroprop-2-enyl)-4-fluoro-2-iodoaniline |
|---|---|
| PubChem CID | 79769670 |
| Molecular Formula | C9H7Cl2FIN |
| Molecular Weight | 345.97 g/mol |
| Exact Mass | 344.90 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)-4-fluoro-2-iodoaniline |
| SMILES | Fc1ccc(NCC(Cl)=CCl)c(I)c1 |
| InChI | InChI=1S/C9H7Cl2FIN/c10-4-6(11)5-14-9-2-1-7(12)3-8(9)13/h1-4,14H,5H2 |
| InChIKey | BDIFAXLJEXUGHF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.97 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|