C9H6BrCl2F2N — CID 107610901
4-bromo-N-[(Z)-2,3-dichloroprop-2-enyl]-2,5-difluoroaniline (PubChem CID 107610901) has the molecular formula C9H6BrCl2F2N and a molecular weight of 316.96 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-2,3-dichloroprop-2-enyl]-2,5-difluoroaniline.
| Compound Name | 4-bromo-N-[(Z)-2,3-dichloroprop-2-enyl]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 107610901 |
| Molecular Formula | C9H6BrCl2F2N |
| Molecular Weight | 316.96 g/mol |
| Exact Mass | 314.90 |
| IUPAC Name | 4-bromo-N-[(Z)-2,3-dichloroprop-2-enyl]-2,5-difluoroaniline |
| SMILES | Fc1cc(NC/C(Cl)=C/Cl)c(F)cc1Br |
| InChI | InChI=1S/C9H6BrCl2F2N/c10-6-1-8(14)9(2-7(6)13)15-4-5(12)3-11/h1-3,15H,4H2/b5-3- |
| InChIKey | ATMDOIUQWRRCFN-HYXAFXHYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.96 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|