C13H14BrF2N — CID 114189923
4-bromo-N-(4,4-dimethylpent-2-ynyl)-2,5-difluoroaniline (PubChem CID 114189923) has the molecular formula C13H14BrF2N and a molecular weight of 302.16 g/mol. Its IUPAC name is 4-bromo-N-(4,4-dimethylpent-2-ynyl)-2,5-difluoroaniline.
| Compound Name | 4-bromo-N-(4,4-dimethylpent-2-ynyl)-2,5-difluoroaniline |
|---|---|
| PubChem CID | 114189923 |
| Molecular Formula | C13H14BrF2N |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 4-bromo-N-(4,4-dimethylpent-2-ynyl)-2,5-difluoroaniline |
| SMILES | CC(C)(C)C#CCNc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C13H14BrF2N/c1-13(2,3)5-4-6-17-12-8-10(15)9(14)7-11(12)16/h7-8,17H,6H2,1-3H3 |
| InChIKey | OHHUVEHRBGUIKA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|