C13H15FIN3O — CID 79771719
N-[[1-(4-fluoro-2-iodophenyl)pyrazol-3-yl]methyl]-2-methoxyethanamine (PubChem CID 79771719) has the molecular formula C13H15FIN3O and a molecular weight of 375.19 g/mol. Its IUPAC name is N-[[1-(4-fluoro-2-iodophenyl)pyrazol-3-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(4-fluoro-2-iodophenyl)pyrazol-3-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 79771719 |
| Molecular Formula | C13H15FIN3O |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | N-[[1-(4-fluoro-2-iodophenyl)pyrazol-3-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccn(-c2ccc(F)cc2I)n1 |
| InChI | InChI=1S/C13H15FIN3O/c1-19-7-5-16-9-11-4-6-18(17-11)13-3-2-10(14)8-12(13)15/h2-4,6,8,16H,5,7,9H2,1H3 |
| InChIKey | XSLBPRHBXKBVFD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|