C13H15ClFN3O — CID 107370965
N-[[1-(3-chloro-5-fluorophenyl)pyrazol-3-yl]methyl]-2-methoxyethanamine (PubChem CID 107370965) has the molecular formula C13H15ClFN3O and a molecular weight of 283.73 g/mol. Its IUPAC name is N-[[1-(3-chloro-5-fluorophenyl)pyrazol-3-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(3-chloro-5-fluorophenyl)pyrazol-3-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 107370965 |
| Molecular Formula | C13H15ClFN3O |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-[[1-(3-chloro-5-fluorophenyl)pyrazol-3-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccn(-c2cc(F)cc(Cl)c2)n1 |
| InChI | InChI=1S/C13H15ClFN3O/c1-19-5-3-16-9-12-2-4-18(17-12)13-7-10(14)6-11(15)8-13/h2,4,6-8,16H,3,5,9H2,1H3 |
| InChIKey | DAJFXNDCPPPFOU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|