C11H10F2N4O — CID 79773151
3-amino-2,6-difluoro-N-(1-methylpyrazol-4-yl)benzamide (PubChem CID 79773151) has the molecular formula C11H10F2N4O and a molecular weight of 252.22 g/mol. Its IUPAC name is 3-amino-2,6-difluoro-N-(1-methylpyrazol-4-yl)benzamide.
| Compound Name | 3-amino-2,6-difluoro-N-(1-methylpyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 79773151 |
| Molecular Formula | C11H10F2N4O |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-amino-2,6-difluoro-N-(1-methylpyrazol-4-yl)benzamide |
| SMILES | Cn1cc(NC(=O)c2c(F)ccc(N)c2F)cn1 |
| InChI | InChI=1S/C11H10F2N4O/c1-17-5-6(4-15-17)16-11(18)9-7(12)2-3-8(14)10(9)13/h2-5H,14H2,1H3,(H,16,18) |
| InChIKey | JPCJBSBMTYMXEC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|