C18H19F2N7O — CID 89283904
3-amino-2,6-difluoro-N-[3-(4-methylpiperazin-1-yl)-1H-pyrazolo[5,4-b]pyridin-5-yl]benzamide (PubChem CID 89283904) has the molecular formula C18H19F2N7O and a molecular weight of 387.39 g/mol. Its IUPAC name is 3-amino-2,6-difluoro-N-[3-(4-methylpiperazin-1-yl)-1H-pyrazolo[5,4-b]pyridin-5-yl]benzamide.
| Compound Name | 3-amino-2,6-difluoro-N-[3-(4-methylpiperazin-1-yl)-1H-pyrazolo[5,4-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 89283904 |
| Molecular Formula | C18H19F2N7O |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-amino-2,6-difluoro-N-[3-(4-methylpiperazin-1-yl)-1H-pyrazolo[5,4-b]pyridin-5-yl]benzamide |
| SMILES | CN1CCN(c2n[nH]c3ncc(NC(=O)c4c(F)ccc(N)c4F)cc23)CC1 |
| InChI | InChI=1S/C18H19F2N7O/c1-26-4-6-27(7-5-26)17-11-8-10(9-22-16(11)24-25-17)23-18(28)14-12(19)2-3-13(21)15(14)20/h2-3,8-9H,4-7,21H2,1H3,(H,23,28)(H,22,24,25) |
| InChIKey | MLBYGJBOXGKYGT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|