C19H11F4N5O — CID 89283875
3-amino-N-[3-(3,5-difluorophenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-2,6-difluorobenzamide (PubChem CID 89283875) has the molecular formula C19H11F4N5O and a molecular weight of 401.32 g/mol. Its IUPAC name is 3-amino-N-[3-(3,5-difluorophenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-2,6-difluorobenzamide.
| Compound Name | 3-amino-N-[3-(3,5-difluorophenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 89283875 |
| Molecular Formula | C19H11F4N5O |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 3-amino-N-[3-(3,5-difluorophenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-2,6-difluorobenzamide |
| SMILES | Nc1ccc(F)c(C(=O)Nc2cnc3n[nH]c(-c4cc(F)cc(F)c4)c3c2)c1F |
| InChI | InChI=1S/C19H11F4N5O/c20-9-3-8(4-10(21)5-9)17-12-6-11(7-25-18(12)28-27-17)26-19(29)15-13(22)1-2-14(24)16(15)23/h1-7H,24H2,(H,26,29)(H,25,27,28) |
| InChIKey | DPCLSYOQINGVQH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|