C13H14N2OS — CID 79774116
5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1,3-thiazol-2-amine (PubChem CID 79774116) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79774116 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(COc2ccc3c(c2)CCC3)s1 |
| InChI | InChI=1S/C13H14N2OS/c14-13-15-7-12(17-13)8-16-11-5-4-9-2-1-3-10(9)6-11/h4-7H,1-3,8H2,(H2,14,15) |
| InChIKey | DGYTVCYHMRIUDD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |