C14H13NO2S — CID 82301125
2-(2,3-dihydro-1H-inden-5-yloxymethyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 82301125) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yloxymethyl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yloxymethyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 82301125 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yloxymethyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(COc2ccc3c(c2)CCC3)s1 |
| InChI | InChI=1S/C14H13NO2S/c16-8-13-7-15-14(18-13)9-17-12-5-4-10-2-1-3-11(10)6-12/h4-8H,1-3,9H2 |
| InChIKey | ZUXIZJVLJKNKDU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|