C11H15N5O2S — CID 79774738
5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-ethyl-1,3-thiazol-2-amine (PubChem CID 79774738) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-ethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79774738 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-ethyl-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(Cn2nc(C)c([N+](=O)[O-])c2C)s1 |
| InChI | InChI=1S/C11H15N5O2S/c1-4-12-11-13-5-9(19-11)6-15-8(3)10(16(17)18)7(2)14-15/h5H,4,6H2,1-3H3,(H,12,13) |
| InChIKey | JATMTQJWXZHUCM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|