C9H9N3S2 — CID 79774891
5-(pyridin-2-ylsulfanylmethyl)-1,3-thiazol-2-amine (PubChem CID 79774891) has the molecular formula C9H9N3S2 and a molecular weight of 223.33 g/mol. Its IUPAC name is 5-(pyridin-2-ylsulfanylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(pyridin-2-ylsulfanylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79774891 |
| Molecular Formula | C9H9N3S2 |
| Molecular Weight | 223.33 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 5-(pyridin-2-ylsulfanylmethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CSc2ccccn2)s1 |
| InChI | InChI=1S/C9H9N3S2/c10-9-12-5-7(14-9)6-13-8-3-1-2-4-11-8/h1-5H,6H2,(H2,10,12) |
| InChIKey | OWFOVOMLZBWMQE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |