C12H18N2O — CID 79775993
N-[(5-but-3-en-2-yloxy-2-pyridinyl)methyl]ethanamine (PubChem CID 79775993) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-[(5-but-3-en-2-yloxy-2-pyridinyl)methyl]ethanamine.
| Compound Name | N-[(5-but-3-en-2-yloxy-2-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 79775993 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-[(5-but-3-en-2-yloxy-2-pyridinyl)methyl]ethanamine |
| SMILES | C=CC(C)Oc1ccc(CNCC)nc1 |
| InChI | InChI=1S/C12H18N2O/c1-4-10(3)15-12-7-6-11(14-9-12)8-13-5-2/h4,6-7,9-10,13H,1,5,8H2,2-3H3 |
| InChIKey | JQGSQKWXIAEUIX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|