C14H22N4O3 — CID 79782281
2-[[6-(ethylaminomethyl)-3-pyridinyl]oxy]-N-(ethylcarbamoyl)propanamide (PubChem CID 79782281) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-[[6-(ethylaminomethyl)-3-pyridinyl]oxy]-N-(ethylcarbamoyl)propanamide.
| Compound Name | 2-[[6-(ethylaminomethyl)-3-pyridinyl]oxy]-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 79782281 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[[6-(ethylaminomethyl)-3-pyridinyl]oxy]-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNCc1ccc(OC(C)C(=O)NC(=O)NCC)cn1 |
| InChI | InChI=1S/C14H22N4O3/c1-4-15-8-11-6-7-12(9-17-11)21-10(3)13(19)18-14(20)16-5-2/h6-7,9-10,15H,4-5,8H2,1-3H3,(H2,16,18,19,20) |
| InChIKey | NNABVTABMQQBRH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |