C15H14INO — CID 79784821
1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-iodo-4-methylpyridin-2-one (PubChem CID 79784821) has the molecular formula C15H14INO and a molecular weight of 351.19 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-iodo-4-methylpyridin-2-one.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-iodo-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 79784821 |
| Molecular Formula | C15H14INO |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-iodo-4-methylpyridin-2-one |
| SMILES | Cc1cc(=O)n(CC2Cc3ccccc32)cc1I |
| InChI | InChI=1S/C15H14INO/c1-10-6-15(18)17(9-14(10)16)8-12-7-11-4-2-3-5-13(11)12/h2-6,9,12H,7-8H2,1H3 |
| InChIKey | MVEOKAKCGBCVGC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|