C12H15IN2O2 — CID 79785172
1-(2-bicyclo[2.2.1]heptanylmethyl)-5-iodopyrimidine-2,4-dione (PubChem CID 79785172) has the molecular formula C12H15IN2O2 and a molecular weight of 346.17 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanylmethyl)-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanylmethyl)-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79785172 |
| Molecular Formula | C12H15IN2O2 |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanylmethyl)-5-iodopyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CC2CC3CCC2C3)cc1I |
| InChI | InChI=1S/C12H15IN2O2/c13-10-6-15(12(17)14-11(10)16)5-9-4-7-1-2-8(9)3-7/h6-9H,1-5H2,(H,14,16,17) |
| InChIKey | FARWMLVGZXOLBE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|