C19H22ClN3O4 — CID 7978522
[2-(4-acetamidophenyl)-2-oxoethyl] 1-butyl-5-chloro-3-methylpyrazole-4-carboxylate (PubChem CID 7978522) has the molecular formula C19H22ClN3O4 and a molecular weight of 391.86 g/mol. Its IUPAC name is [2-(4-acetamidophenyl)-2-oxoethyl] 1-butyl-5-chloro-3-methylpyrazole-4-carboxylate.
| Compound Name | [2-(4-acetamidophenyl)-2-oxoethyl] 1-butyl-5-chloro-3-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 7978522 |
| Molecular Formula | C19H22ClN3O4 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [2-(4-acetamidophenyl)-2-oxoethyl] 1-butyl-5-chloro-3-methylpyrazole-4-carboxylate |
| SMILES | CCCCn1nc(C)c(C(=O)OCC(=O)c2ccc(NC(C)=O)cc2)c1Cl |
| InChI | InChI=1S/C19H22ClN3O4/c1-4-5-10-23-18(20)17(12(2)22-23)19(26)27-11-16(25)14-6-8-15(9-7-14)21-13(3)24/h6-9H,4-5,10-11H2,1-3H3,(H,21,24) |
| InChIKey | CRNACGMKIGFJBC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |