C15H18ClN3O3 — CID 7978529
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 1-butyl-5-chloro-3-methylpyrazole-4-carboxylate (PubChem CID 7978529) has the molecular formula C15H18ClN3O3 and a molecular weight of 323.78 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 1-butyl-5-chloro-3-methylpyrazole-4-carboxylate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 1-butyl-5-chloro-3-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 7978529 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 1-butyl-5-chloro-3-methylpyrazole-4-carboxylate |
| SMILES | CCCCn1nc(C)c(C(=O)OCC(=O)c2ccc[nH]2)c1Cl |
| InChI | InChI=1S/C15H18ClN3O3/c1-3-4-8-19-14(16)13(10(2)18-19)15(21)22-9-12(20)11-6-5-7-17-11/h5-7,17H,3-4,8-9H2,1-2H3 |
| InChIKey | GDGIBXMBOXDAPD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |