C12H10Br2O5 — CID 79787065
3-bromo-4-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-oxobutanoic acid (PubChem CID 79787065) has the molecular formula C12H10Br2O5 and a molecular weight of 394.02 g/mol. Its IUPAC name is 3-bromo-4-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-oxobutanoic acid.
| Compound Name | 3-bromo-4-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 79787065 |
| Molecular Formula | C12H10Br2O5 |
| Molecular Weight | 394.02 g/mol |
| Exact Mass | 391.89 |
| IUPAC Name | 3-bromo-4-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-4-oxobutanoic acid |
| SMILES | O=C(O)CC(Br)C(=O)c1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C12H10Br2O5/c13-7-4-10-9(18-1-2-19-10)3-6(7)12(17)8(14)5-11(15)16/h3-4,8H,1-2,5H2,(H,15,16) |
| InChIKey | VNNGQRPTYXXVRJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.02 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|