C10H6BrClF2O3 — CID 107475874
3-bromo-4-(2-chloro-4,5-difluorophenyl)-4-oxobutanoic acid (PubChem CID 107475874) has the molecular formula C10H6BrClF2O3 and a molecular weight of 327.51 g/mol. Its IUPAC name is 3-bromo-4-(2-chloro-4,5-difluorophenyl)-4-oxobutanoic acid.
| Compound Name | 3-bromo-4-(2-chloro-4,5-difluorophenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107475874 |
| Molecular Formula | C10H6BrClF2O3 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 325.92 |
| IUPAC Name | 3-bromo-4-(2-chloro-4,5-difluorophenyl)-4-oxobutanoic acid |
| SMILES | O=C(O)CC(Br)C(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C10H6BrClF2O3/c11-5(2-9(15)16)10(17)4-1-7(13)8(14)3-6(4)12/h1,3,5H,2H2,(H,15,16) |
| InChIKey | VEIRUEPKDQFTLP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|