C13H17FN2O3 — CID 79789124
2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]-2-methylbutanoic acid (PubChem CID 79789124) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]-2-methylbutanoic acid.
| Compound Name | 2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 79789124 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NCC(=O)Nc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C13H17FN2O3/c1-3-13(2,12(18)19)15-8-11(17)16-10-7-5-4-6-9(10)14/h4-7,15H,3,8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | TWMWXTIEFIELTP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |