C15H19N3O3 — CID 79789852
2-[[2-[N-(cyanomethyl)anilino]-2-oxoethyl]amino]-2-methylbutanoic acid (PubChem CID 79789852) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[[2-[N-(cyanomethyl)anilino]-2-oxoethyl]amino]-2-methylbutanoic acid.
| Compound Name | 2-[[2-[N-(cyanomethyl)anilino]-2-oxoethyl]amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 79789852 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[[2-[N-(cyanomethyl)anilino]-2-oxoethyl]amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NCC(=O)N(CC#N)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H19N3O3/c1-3-15(2,14(20)21)17-11-13(19)18(10-9-16)12-7-5-4-6-8-12/h4-8,17H,3,10-11H2,1-2H3,(H,20,21) |
| InChIKey | MXDSNBRLICKDEN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|