C10H16N2O3 — CID 79794461
6-[[(2-hydroxy-3-methoxypropyl)amino]methyl]pyridin-3-ol (PubChem CID 79794461) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 6-[[(2-hydroxy-3-methoxypropyl)amino]methyl]pyridin-3-ol.
| Compound Name | 6-[[(2-hydroxy-3-methoxypropyl)amino]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 79794461 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 6-[[(2-hydroxy-3-methoxypropyl)amino]methyl]pyridin-3-ol |
| SMILES | COCC(O)CNCc1ccc(O)cn1 |
| InChI | InChI=1S/C10H16N2O3/c1-15-7-10(14)5-11-4-8-2-3-9(13)6-12-8/h2-3,6,10-11,13-14H,4-5,7H2,1H3 |
| InChIKey | CPOVWRXHAVHTKI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |