C12H20N2O3 — CID 113384066
6-[[(2-hydroxy-4-methoxy-2-methylbutyl)amino]methyl]pyridin-3-ol (PubChem CID 113384066) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 6-[[(2-hydroxy-4-methoxy-2-methylbutyl)amino]methyl]pyridin-3-ol.
| Compound Name | 6-[[(2-hydroxy-4-methoxy-2-methylbutyl)amino]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 113384066 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 6-[[(2-hydroxy-4-methoxy-2-methylbutyl)amino]methyl]pyridin-3-ol |
| SMILES | COCCC(C)(O)CNCc1ccc(O)cn1 |
| InChI | InChI=1S/C12H20N2O3/c1-12(16,5-6-17-2)9-13-7-10-3-4-11(15)8-14-10/h3-4,8,13,15-16H,5-7,9H2,1-2H3 |
| InChIKey | CZKNYKJAXTXPGQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |