C12H10F3N3O2 — CID 79798204
3,3,3-trifluoro-2-methyl-2-(phthalazin-1-ylamino)propanoic acid (PubChem CID 79798204) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-(phthalazin-1-ylamino)propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-(phthalazin-1-ylamino)propanoic acid |
|---|---|
| PubChem CID | 79798204 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-(phthalazin-1-ylamino)propanoic acid |
| SMILES | CC(Nc1nncc2ccccc12)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C12H10F3N3O2/c1-11(10(19)20,12(13,14)15)17-9-8-5-3-2-4-7(8)6-16-18-9/h2-6H,1H3,(H,17,18)(H,19,20) |
| InChIKey | VUSMCWITUHUDPR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |