C11H17F3N2O3 — CID 79799158
2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 79799158) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid.
| Compound Name | 2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79799158 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid |
| SMILES | C=C(C)CN(CC)C(=O)NC(C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O3/c1-5-16(6-7(2)3)9(19)15-10(4,8(17)18)11(12,13)14/h2,5-6H2,1,3-4H3,(H,15,19)(H,17,18) |
| InChIKey | OUAYTWGIYOAUIU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|