C7H5F8NO3 — CID 114037966
3,3,3-trifluoro-2-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)propanoic acid (PubChem CID 114037966) has the molecular formula C7H5F8NO3 and a molecular weight of 303.11 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 114037966 |
| Molecular Formula | C7H5F8NO3 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)propanoic acid |
| SMILES | CC(NC(=O)C(F)(F)C(F)(F)F)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C7H5F8NO3/c1-4(3(18)19,6(10,11)12)16-2(17)5(8,9)7(13,14)15/h1H3,(H,16,17)(H,18,19) |
| InChIKey | QLDWZYYTSZQJDT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|