C11H22N2O5 — CID 79800977
2-[[(2-hydroxy-3-methoxypropyl)-methylcarbamoyl]amino]-2-methylbutanoic acid (PubChem CID 79800977) has the molecular formula C11H22N2O5 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[[(2-hydroxy-3-methoxypropyl)-methylcarbamoyl]amino]-2-methylbutanoic acid.
| Compound Name | 2-[[(2-hydroxy-3-methoxypropyl)-methylcarbamoyl]amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 79800977 |
| Molecular Formula | C11H22N2O5 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-[[(2-hydroxy-3-methoxypropyl)-methylcarbamoyl]amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NC(=O)N(C)CC(O)COC)C(=O)O |
| InChI | InChI=1S/C11H22N2O5/c1-5-11(2,9(15)16)12-10(17)13(3)6-8(14)7-18-4/h8,14H,5-7H2,1-4H3,(H,12,17)(H,15,16) |
| InChIKey | ZWUOJWLVKYYWRP-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |