C12H24N2O6 — CID 81085623
2-[[(2-hydroxy-3-methoxypropyl)-methylcarbamoyl]amino]-5-methoxypentanoic acid (PubChem CID 81085623) has the molecular formula C12H24N2O6 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[[(2-hydroxy-3-methoxypropyl)-methylcarbamoyl]amino]-5-methoxypentanoic acid.
| Compound Name | 2-[[(2-hydroxy-3-methoxypropyl)-methylcarbamoyl]amino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81085623 |
| Molecular Formula | C12H24N2O6 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-[[(2-hydroxy-3-methoxypropyl)-methylcarbamoyl]amino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NC(=O)N(C)CC(O)COC)C(=O)O |
| InChI | InChI=1S/C12H24N2O6/c1-14(7-9(15)8-20-3)12(18)13-10(11(16)17)5-4-6-19-2/h9-10,15H,4-8H2,1-3H3,(H,13,18)(H,16,17) |
| InChIKey | SRYUZFVAQNPXFA-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|