C12H11Cl2NS — CID 79802256
(2,5-dichlorophenyl)-(4-methylthiophen-3-yl)methanamine (PubChem CID 79802256) has the molecular formula C12H11Cl2NS and a molecular weight of 272.20 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(4-methylthiophen-3-yl)methanamine.
| Compound Name | (2,5-dichlorophenyl)-(4-methylthiophen-3-yl)methanamine |
|---|---|
| PubChem CID | 79802256 |
| Molecular Formula | C12H11Cl2NS |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | (2,5-dichlorophenyl)-(4-methylthiophen-3-yl)methanamine |
| SMILES | Cc1cscc1C(N)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H11Cl2NS/c1-7-5-16-6-10(7)12(15)9-4-8(13)2-3-11(9)14/h2-6,12H,15H2,1H3 |
| InChIKey | WBFCORSXRDZFBP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |