C12H18N4O3 — CID 79806253
ethyl 1-[2-(triazol-1-yl)acetyl]piperidine-4-carboxylate (PubChem CID 79806253) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is ethyl 1-[2-(triazol-1-yl)acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(triazol-1-yl)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 79806253 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | ethyl 1-[2-(triazol-1-yl)acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)Cn2ccnn2)CC1 |
| InChI | InChI=1S/C12H18N4O3/c1-2-19-12(18)10-3-6-15(7-4-10)11(17)9-16-8-5-13-14-16/h5,8,10H,2-4,6-7,9H2,1H3 |
| InChIKey | DHDNWLHPKVHMKI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |