C12H21N3O4S — CID 79806387
2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]butanoic acid (PubChem CID 79806387) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]butanoic acid.
| Compound Name | 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 79806387 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-ethyl-2-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]butanoic acid |
| SMILES | CCn1cc(S(=O)(=O)NC(CC)(CC)C(=O)O)nc1C |
| InChI | InChI=1S/C12H21N3O4S/c1-5-12(6-2,11(16)17)14-20(18,19)10-8-15(7-3)9(4)13-10/h8,14H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | PYTLMCJZLCZDGV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |