C11H21NO6S2 — CID 79806557
2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-ethylbutanoic acid (PubChem CID 79806557) has the molecular formula C11H21NO6S2 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-ethylbutanoic acid.
| Compound Name | 2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 79806557 |
| Molecular Formula | C11H21NO6S2 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)sulfonylamino]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(NS(=O)(=O)C1CCS(=O)(=O)CC1)C(=O)O |
| InChI | InChI=1S/C11H21NO6S2/c1-3-11(4-2,10(13)14)12-20(17,18)9-5-7-19(15,16)8-6-9/h9,12H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | IIYMLMWCDJHLCM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |