6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid

C13H26N2O3 — CID 79812253

IUPAC6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid
SMILESCCC(C)(N)C(=O)NCCC(C)(C)CCC(=O)O
InChIInChI=1S/C13H26N2O3/c1-5-13(4,14)11(18)15-9-8-12(2,3)7-6-10(16)17/h5-9,14H2,1-4H3,(H,15,18)(H,16,17)
InChIKeyOUHZWEXFOPODDC-UHFFFAOYSA-N
MW258.36 g/mol
LogP1.51
Rot. Bonds8

About 6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid

6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid (PubChem CID 79812253) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid.

Molecular Properties

Compound Name6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid
PubChem CID79812253
Molecular FormulaC13H26N2O3
Molecular Weight258.36 g/mol
Exact Mass258.19
IUPAC Name6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid
SMILESCCC(C)(N)C(=O)NCCC(C)(C)CCC(=O)O
InChIInChI=1S/C13H26N2O3/c1-5-13(4,14)11(18)15-9-8-12(2,3)7-6-10(16)17/h5-9,14H2,1-4H3,(H,15,18)(H,16,17)
InChIKeyOUHZWEXFOPODDC-UHFFFAOYSA-N
XLogP1.51
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.36
LogP ≤ 51.51
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid?
The IUPAC name of 6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid (CID 79812253) is 6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid.
What is the SMILES notation for 6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid?
The canonical SMILES for 6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid is CCC(C)(N)C(=O)NCCC(C)(C)CCC(=O)O.
What is the InChIKey of 6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid?
The InChIKey is OUHZWEXFOPODDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O3/c1-5-13(4,14)11(18)15-9-8-12(2,3)7-6-10(16)17/h5-9,14H2,1-4H3,(H,15,18)(H,16,17).
What are the key properties of 6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid?
6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid has a molecular weight of 258.36 g/mol, XLogP of 1.51, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-amino-2-methylbutanoyl)amino]-4,4-dimethylhexanoic acid is sourced from PubChem (CID 79812253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).