C11H16N4O4 — CID 79815567
methyl 3-[(6-amino-5-nitro-2-pyridinyl)-methylamino]-2-methylpropanoate (PubChem CID 79815567) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is methyl 3-[(6-amino-5-nitro-2-pyridinyl)-methylamino]-2-methylpropanoate.
| Compound Name | methyl 3-[(6-amino-5-nitro-2-pyridinyl)-methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 79815567 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | methyl 3-[(6-amino-5-nitro-2-pyridinyl)-methylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CN(C)c1ccc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C11H16N4O4/c1-7(11(16)19-3)6-14(2)9-5-4-8(15(17)18)10(12)13-9/h4-5,7H,6H2,1-3H3,(H2,12,13) |
| InChIKey | PNXVOQYDLGDMAB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|