C13H18ClNS — CID 79816785
4-tert-butyl-2-[(3-chlorocyclopenten-1-yl)methyl]-1,3-thiazole (PubChem CID 79816785) has the molecular formula C13H18ClNS and a molecular weight of 255.81 g/mol. Its IUPAC name is 4-tert-butyl-2-[(3-chlorocyclopenten-1-yl)methyl]-1,3-thiazole.
| Compound Name | 4-tert-butyl-2-[(3-chlorocyclopenten-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79816785 |
| Molecular Formula | C13H18ClNS |
| Molecular Weight | 255.81 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-tert-butyl-2-[(3-chlorocyclopenten-1-yl)methyl]-1,3-thiazole |
| SMILES | CC(C)(C)c1csc(CC2=CC(Cl)CC2)n1 |
| InChI | InChI=1S/C13H18ClNS/c1-13(2,3)11-8-16-12(15-11)7-9-4-5-10(14)6-9/h6,8,10H,4-5,7H2,1-3H3 |
| InChIKey | WMMNLGHQYZCDRT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|