C9H13N5O — CID 79817366
2-methoxy-N-([1,2,4]triazolo[4,3-c]pyrimidin-3-ylmethyl)ethanamine (PubChem CID 79817366) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 2-methoxy-N-([1,2,4]triazolo[4,3-c]pyrimidin-3-ylmethyl)ethanamine.
| Compound Name | 2-methoxy-N-([1,2,4]triazolo[4,3-c]pyrimidin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 79817366 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-methoxy-N-([1,2,4]triazolo[4,3-c]pyrimidin-3-ylmethyl)ethanamine |
| SMILES | COCCNCc1nnc2ccncn12 |
| InChI | InChI=1S/C9H13N5O/c1-15-5-4-10-6-9-13-12-8-2-3-11-7-14(8)9/h2-3,7,10H,4-6H2,1H3 |
| InChIKey | KCIGMZMCBFOQFN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|