C15H18N2OS — CID 79818587
3-(1,3-benzothiazol-2-ylmethyl)-1-cyclopropylpyrrolidin-3-ol (PubChem CID 79818587) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylmethyl)-1-cyclopropylpyrrolidin-3-ol.
| Compound Name | 3-(1,3-benzothiazol-2-ylmethyl)-1-cyclopropylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 79818587 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylmethyl)-1-cyclopropylpyrrolidin-3-ol |
| SMILES | OC1(Cc2nc3ccccc3s2)CCN(C2CC2)C1 |
| InChI | InChI=1S/C15H18N2OS/c18-15(7-8-17(10-15)11-5-6-11)9-14-16-12-3-1-2-4-13(12)19-14/h1-4,11,18H,5-10H2 |
| InChIKey | PELORDGJJAIPFI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |