C17H23NOS — CID 79818593
1-(1,3-benzothiazol-2-ylmethyl)-4,4-dimethylcycloheptan-1-ol (PubChem CID 79818593) has the molecular formula C17H23NOS and a molecular weight of 289.44 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-4,4-dimethylcycloheptan-1-ol.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-4,4-dimethylcycloheptan-1-ol |
|---|---|
| PubChem CID | 79818593 |
| Molecular Formula | C17H23NOS |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-4,4-dimethylcycloheptan-1-ol |
| SMILES | CC1(C)CCCC(O)(Cc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C17H23NOS/c1-16(2)8-5-9-17(19,11-10-16)12-15-18-13-6-3-4-7-14(13)20-15/h3-4,6-7,19H,5,8-12H2,1-2H3 |
| InChIKey | DATACFLQLQPENF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |