C13H17NO4 — CID 7982005
[(2S)-1-amino-1-oxopropan-2-yl] 2-(2,3-dimethylphenoxy)acetate (PubChem CID 7982005) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-(2,3-dimethylphenoxy)acetate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-(2,3-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 7982005 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-(2,3-dimethylphenoxy)acetate |
| SMILES | Cc1cccc(OCC(=O)O[C@@H](C)C(N)=O)c1C |
| InChI | InChI=1S/C13H17NO4/c1-8-5-4-6-11(9(8)2)17-7-12(15)18-10(3)13(14)16/h4-6,10H,7H2,1-3H3,(H2,14,16)/t10-/m0/s1 |
| InChIKey | LTLSJFJQCDOMIK-JTQLQIEISA-N |
| XLogP | 1.10 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |