C15H19ClN2OS — CID 79820270
1-(2-amino-4-chlorophenyl)-2-(4-tert-butyl-1,3-thiazol-2-yl)ethanol (PubChem CID 79820270) has the molecular formula C15H19ClN2OS and a molecular weight of 310.85 g/mol. Its IUPAC name is 1-(2-amino-4-chlorophenyl)-2-(4-tert-butyl-1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(2-amino-4-chlorophenyl)-2-(4-tert-butyl-1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 79820270 |
| Molecular Formula | C15H19ClN2OS |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(2-amino-4-chlorophenyl)-2-(4-tert-butyl-1,3-thiazol-2-yl)ethanol |
| SMILES | CC(C)(C)c1csc(CC(O)c2ccc(Cl)cc2N)n1 |
| InChI | InChI=1S/C15H19ClN2OS/c1-15(2,3)13-8-20-14(18-13)7-12(19)10-5-4-9(16)6-11(10)17/h4-6,8,12,19H,7,17H2,1-3H3 |
| InChIKey | FBHHUGNLLXAELK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|