C15H17F2NOS — CID 79820006
2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(2,4-difluorophenyl)ethanol (PubChem CID 79820006) has the molecular formula C15H17F2NOS and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(2,4-difluorophenyl)ethanol.
| Compound Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(2,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 79820006 |
| Molecular Formula | C15H17F2NOS |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(2,4-difluorophenyl)ethanol |
| SMILES | CC(C)(C)c1csc(CC(O)c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C15H17F2NOS/c1-15(2,3)13-8-20-14(18-13)7-12(19)10-5-4-9(16)6-11(10)17/h4-6,8,12,19H,7H2,1-3H3 |
| InChIKey | OVMUEKXGGXMQTN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |