C15H17BrF2N2S — CID 107538587
1-(2-bromo-3,4-difluorophenyl)-2-(4-tert-butyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 107538587) has the molecular formula C15H17BrF2N2S and a molecular weight of 375.28 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(4-tert-butyl-1,3-thiazol-2-yl)ethanamine.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(4-tert-butyl-1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 107538587 |
| Molecular Formula | C15H17BrF2N2S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(4-tert-butyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | CC(C)(C)c1csc(CC(N)c2ccc(F)c(F)c2Br)n1 |
| InChI | InChI=1S/C15H17BrF2N2S/c1-15(2,3)11-7-21-12(20-11)6-10(19)8-4-5-9(17)14(18)13(8)16/h4-5,7,10H,6,19H2,1-3H3 |
| InChIKey | ZEAWYFPPGZCMNX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|