C9H13N5 — CID 79821275
2-(2-aminopropan-2-yl)-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79821275) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 2-(2-aminopropan-2-yl)-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-(2-aminopropan-2-yl)-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79821275 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 2-(2-aminopropan-2-yl)-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CC(C)(N)c1nc2nc(N)ccc2[nH]1 |
| InChI | InChI=1S/C9H13N5/c1-9(2,11)8-12-5-3-4-6(10)13-7(5)14-8/h3-4H,11H2,1-2H3,(H3,10,12,13,14) |
| InChIKey | NUZTWJZRFZUIFO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |