C9H13NO2S — CID 79823764
1-(oxolan-3-yl)-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 79823764) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(oxolan-3-yl)-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 79823764 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 1-(oxolan-3-yl)-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | OC(Cc1nccs1)C1CCOC1 |
| InChI | InChI=1S/C9H13NO2S/c11-8(7-1-3-12-6-7)5-9-10-2-4-13-9/h2,4,7-8,11H,1,3,5-6H2 |
| InChIKey | IVFIEXZHGMTNRD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |