C17H17NO2S — CID 79825717
1-(1,3-benzothiazol-2-yl)-2-(3-methoxyphenyl)propan-2-ol (PubChem CID 79825717) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-2-(3-methoxyphenyl)propan-2-ol.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-2-(3-methoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 79825717 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-2-(3-methoxyphenyl)propan-2-ol |
| SMILES | COc1cccc(C(C)(O)Cc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C17H17NO2S/c1-17(19,12-6-5-7-13(10-12)20-2)11-16-18-14-8-3-4-9-15(14)21-16/h3-10,19H,11H2,1-2H3 |
| InChIKey | STYYWYMJZNHSMN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |