C11H9Cl2N3O — CID 79826072
6-(2,3-dichlorophenoxy)pyridine-2,3-diamine (PubChem CID 79826072) has the molecular formula C11H9Cl2N3O and a molecular weight of 270.12 g/mol. Its IUPAC name is 6-(2,3-dichlorophenoxy)pyridine-2,3-diamine.
| Compound Name | 6-(2,3-dichlorophenoxy)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 79826072 |
| Molecular Formula | C11H9Cl2N3O |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 6-(2,3-dichlorophenoxy)pyridine-2,3-diamine |
| SMILES | Nc1ccc(Oc2cccc(Cl)c2Cl)nc1N |
| InChI | InChI=1S/C11H9Cl2N3O/c12-6-2-1-3-8(10(6)13)17-9-5-4-7(14)11(15)16-9/h1-5H,14H2,(H2,15,16) |
| InChIKey | OGWCPRXCHDBRLI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |