C13H12Cl2N2O — CID 80639795
2-[6-(2,3-dichlorophenoxy)-3-pyridinyl]ethanamine (PubChem CID 80639795) has the molecular formula C13H12Cl2N2O and a molecular weight of 283.16 g/mol. Its IUPAC name is 2-[6-(2,3-dichlorophenoxy)-3-pyridinyl]ethanamine.
| Compound Name | 2-[6-(2,3-dichlorophenoxy)-3-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 80639795 |
| Molecular Formula | C13H12Cl2N2O |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2-[6-(2,3-dichlorophenoxy)-3-pyridinyl]ethanamine |
| SMILES | NCCc1ccc(Oc2cccc(Cl)c2Cl)nc1 |
| InChI | InChI=1S/C13H12Cl2N2O/c14-10-2-1-3-11(13(10)15)18-12-5-4-9(6-7-16)8-17-12/h1-5,8H,6-7,16H2 |
| InChIKey | BOHYEUFIKCJWDO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |