C18H22N2S — CID 79826392
5,5-dimethyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]cyclohex-2-en-1-amine (PubChem CID 79826392) has the molecular formula C18H22N2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 5,5-dimethyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]cyclohex-2-en-1-amine.
| Compound Name | 5,5-dimethyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 79826392 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 5,5-dimethyl-3-[(4-phenyl-1,3-thiazol-2-yl)methyl]cyclohex-2-en-1-amine |
| SMILES | CC1(C)CC(Cc2nc(-c3ccccc3)cs2)=CC(N)C1 |
| InChI | InChI=1S/C18H22N2S/c1-18(2)10-13(8-15(19)11-18)9-17-20-16(12-21-17)14-6-4-3-5-7-14/h3-8,12,15H,9-11,19H2,1-2H3 |
| InChIKey | BSORTIQSRMLNBJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|